y19akramri y19akramri

21-11-2021
Mathematics

contestada

What are the integer solutions to the inequality below?

[tex]10 \leq 2x \leq x+7[/tex]

Respuesta :

brainliestanswerer brainliestanswerer

21-11-2021

Here's ur perfect answer

Ver imagen brainliestanswerer

Answer Link

Otras preguntas

What is the concentration ratio in an industry with the following market shares? instructions: enter your response as a percentage rounded to one decimal place

π + √70 to the nearest hundredth8.37 11.14 11.51 12.14

A firm's return on equity is 18 percent and its retention ratio is 40 percent. what is its sustainable growth rate?

45 divided by (7 + 2^{3}) X 7

How do increases in the retail and wholesale margins (again, with a fixed retail price) affect the unit contribution?

A relationship between two variables in which one variable increases at the same time as the other decreases is called:________ a. direct. b. nonlinear. c. co

A long power line has a steady current of 125 a flowing through it. what is the strength of the resulting magnetic field at a distance of 1.25 m from the wire?

Which skeletal structure corresponds to the condensed structure ch2(oh)ch2chchco2ch(ch3)2?

One paper cup needs 43 g of wood. Americans use 50 million paper cups each day. Approximately how much wood is getting wasted by Americans each day due to the u

At which lettered point or points is the object moving the fastest? check all that apply.